Index of /My Music/mp3 new/VA - Hit Parade De Danse (2011) - SMG
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[TXT]](/icons/text.gif) | 00._A.S.Y.S._-_.nfo | 2012-08-19 11:39 | 53K | |
![[SND]](/icons/sound2.gif) | A.S.Y.S. - bassturba..> | 2012-08-19 11:58 | 14M | |
| ATrak - Ray Ban Visi..> | 2012-08-19 11:58 | 8.7M | |
| Aboutblank & KLC - M..> | 2012-08-19 11:53 | 14M | |
| Acid Luke feat Tony ..> | 2012-08-19 11:42 | 10M | |
| Acosta Wink - Magent..> | 2012-08-19 11:54 | 10M | |
| Activ & Optick - Be ..> | 2012-08-19 11:49 | 15M | |
| Adam Lambert - If I ..> | 2012-08-19 11:52 | 13M | |
| Adele - Rolling In T..> | 2012-08-19 11:58 | 13M | |
| Adele - Set Fire To ..> | 2012-08-19 11:59 | 13M | |
| Aelin - Believe In U..> | 2012-08-19 11:58 | 9.6M | |
| Aeon pulse - Powerco..> | 2012-08-19 11:57 | 14M | |
| Afrojack & Steve Aok..> | 2012-08-19 11:53 | 14M | |
| Afrojack, Dimitri Ve..> | 2012-08-19 11:52 | 17M | |
| Afrojack - Esther (L..> | 2012-08-19 11:54 | 16M | |
| Afrojack - Thief.mp3 | 2012-08-19 11:52 | 18M | |
| Akon feat. Pitbull a..> | 2012-08-19 11:53 | 11M | |
| Al Bizzare - Fresh S..> | 2012-08-19 12:00 | 11M | |
| Al Cappucino Ft. Fri..> | 2012-08-19 11:58 | 12M | |
| Alessia - find me (A..> | 2012-08-19 11:49 | 8.7M | |
| Alex Mourinho - I Ca..> | 2012-08-19 11:58 | 15M | |
| Alex Sayz ft Nadia A..> | 2012-08-19 11:53 | 17M | |
| Alex Spite - Moonlig..> | 2012-08-19 11:53 | 15M | |
| Alexandra Stan - Ene..> | 2012-08-19 12:00 | 10M | |
| Alexandra Stan - Mr...> | 2012-08-19 12:00 | 14M | |
| Alexandra Stan - Mr...> | 2012-08-19 12:00 | 14M | |
| Alexandra Stan feat...> | 2012-08-19 12:00 | 13M | |
| Ali Wilson and Lee O..> | 2012-08-19 11:54 | 18M | |
| Alice feat. Pierre H..> | 2012-08-19 11:59 | 12M | |
| Allan Natal ft Leila..> | 2012-08-19 11:56 | 17M | |
| Alle feat. Club Proj..> | 2012-08-19 11:54 | 8.4M | |
| Alli Davis ft. Hot R..> | 2012-08-19 11:53 | 8.7M | |
| Allure feat. JES - S..> | 2012-08-19 11:54 | 14M | |
| Allure feat Jeza - y..> | 2012-08-19 11:58 | 12M | |
| Amari feat. Phelipe ..> | 2012-08-19 11:43 | 13M | |
| Amna - Tell Me Why (..> | 2012-08-19 11:42 | 12M | |
| Amoko feat C bastio..> | 2012-08-19 11:43 | 8.1M | |
| Amsterdam Avenue fea..> | 2012-08-19 12:00 | 8.9M | |
| Amurai feat. Sean - ..> | 2012-08-19 11:53 | 17M | |
| Ana - Voices (Niko N..> | 2012-08-19 11:54 | 12M | |
| Anda Adam - Trust (D..> | 2012-08-19 11:53 | 11M | |
| Andeeno Damassy feat..> | 2012-08-19 11:59 | 14M | |
| Andreea Banica feat...> | 2012-08-19 11:59 | 13M | |
| Andrew Bennett - Age..> | 2012-08-19 11:56 | 14M | |
| Anne Lee - new hope.mp3 | 2012-08-19 11:57 | 16M | |
| Antoine Сlamaran fe..> | 2012-08-19 11:50 | 19M | |
| Anya - Desire.mp3 | 2012-08-19 11:53 | 8.4M | |
| Aquile & TeeB feat. ..> | 2012-08-19 12:00 | 16M | |
| Arkada - Feeling Fin..> | 2012-08-19 11:48 | 11M | |
| Armin Van Buuren - ..> | 2012-08-19 11:52 | 20M | |
| Armin Van Buuren fea..> | 2012-08-19 12:00 | 14M | |
| Armin Van Buuren fea..> | 2012-08-19 11:58 | 12M | |
| Armin Van Buuren fea..> | 2012-08-19 12:00 | 17M | |
| Armin Van Buuren fea..> | 2012-08-19 11:58 | 6.5M | |
| Armin Van Buuren vs ..> | 2012-08-19 11:59 | 10M | |
| Armin van Buuren vs...> | 2012-08-19 11:55 | 16M | |
| Arnej feat. Sally Sa..> | 2012-08-19 11:57 | 17M | |
| Arno Cost and Martin..> | 2012-08-19 11:55 | 16M | |
| Artento Divini - Gri..> | 2012-08-19 11:55 | 16M | |
| Astero and Inusa Daw..> | 2012-08-19 11:58 | 7.1M | |
| Audio Affinity feat...> | 2012-08-19 11:52 | 9.4M | |
| Avicii - Malo.mp3 | 2012-08-19 12:00 | 17M | |
| Avicii - Street Danc..> | 2012-08-19 11:53 | 16M | |
| Axwell & Bob Sinclar..> | 2012-08-19 11:54 | 17M | |
| Azuro - Ti Amo (feat..> | 2012-08-19 12:00 | 8.7M | |
| Baccano & Matt Steve..> | 2012-08-19 11:55 | 15M | |
| Bangboy - Verdammt L..> | 2012-08-19 11:54 | 13M | |
| Bart Claessen & Dave..> | 2012-08-19 11:53 | 16M | |
| Basement Jaxx feat. ..> | 2012-08-19 11:48 | 11M | |
| Basslovers United - ..> | 2012-08-19 12:00 | 13M | |
| Basto - Gregorys The..> | 2012-08-19 11:49 | 13M | |
| Belle Amie - Girls U..> | 2012-08-19 12:00 | 18M | |
| Belmond & Parker - O..> | 2012-08-19 11:54 | 14M | |
| Ben Preston feat. Ma..> | 2012-08-19 11:56 | 17M | |
| Benny Benassi & Pitb..> | 2012-08-19 11:49 | 7.9M | |
| Benny Benassi - Sati..> | 2012-08-19 11:56 | 15M | |
| Benny Benassi feat. ..> | 2012-08-19 12:00 | 7.1M | |
| Benny Benassi feat. ..> | 2012-08-19 11:57 | 13M | |
| Bertinio vs Melodie ..> | 2012-08-19 11:55 | 7.3M | |
| Beuore - reet art .mp3 | 2012-08-19 12:00 | 13M | |
| Beyonce - Who Run Th..> | 2012-08-19 11:58 | 14M | |
| Biank & Yannis - Day..> | 2012-08-19 11:53 | 7.2M | |
| Bingo Players - Get ..> | 2012-08-19 11:55 | 14M | |
| Bob Sinclar and Sean..> | 2012-08-19 11:54 | 7.2M | |
| Bobina & Betsie Lark..> | 2012-08-19 11:59 | 19M | |
| Boemklatsch ft. Prin..> | 2012-08-19 11:54 | 9.4M | |
| Brazen feat. Ellenyi..> | 2012-08-19 11:55 | 16M | |
| Breakage and Twin At..> | 2012-08-19 11:55 | 8.9M | |
| Britney Spears – I..> | 2012-08-19 11:59 | 10M | |
| Britney Spears - Hol..> | 2012-08-19 11:53 | 14M | |
| Britney Spears - Til..> | 2012-08-19 11:59 | 17M | |
| Britt - Fcking Vet!!..> | 2012-08-19 11:54 | 7.8M | |
| Brooklyn Bounce - Ba..> | 2012-08-19 11:56 | 10M | |
| Brooklyn Bounce Vs. ..> | 2012-08-19 11:45 | 12M | |
| Bros Project feat. D..> | 2012-08-19 11:57 | 9.0M | |
| Bruk and Static - Ho..> | 2012-08-19 11:51 | 14M | |
| Bryce feat. Carlprit..> | 2012-08-19 11:59 | 7.9M | |
| C-Bool - House Baby ..> | 2012-08-19 11:56 | 13M | |
| CJ Stone - Mindful T..> | 2012-08-19 11:54 | 14M | |
| Candy Shop Project -..> | 2012-08-19 11:54 | 16M | |
| Canned Tucky Beat - ..> | 2012-08-19 11:56 | 12M | |
| Cascada - Night Nurs..> | 2012-08-19 11:54 | 14M | |
| Cascada - Original M..> | 2012-08-19 11:56 | 7.3M | |
| Cascada - Stalker.mp3 | 2012-08-19 11:55 | 8.1M | |
| Celia - Daddy Down (..> | 2012-08-19 11:46 | 11M | |
| Chase & Status - Fla..> | 2012-08-19 11:56 | 9.7M | |
| Chase & Status Fe. D..> | 2012-08-19 11:59 | 9.9M | |
| Cher Lloyd - Swagger..> | 2012-08-19 11:59 | 16M | |
| Cherry Coke - Milky ..> | 2012-08-19 11:57 | 13M | |
| Chicane - where do i..> | 2012-08-19 11:57 | 7.5M | |
| Chris Parker - Symph..> | 2012-08-19 11:55 | 7.9M | |
| Christian Falero and..> | 2012-08-19 11:56 | 20M | |
| Christina Aguilera -..> | 2012-08-19 11:58 | 8.8M | |
| Christina Aguilera -..> | 2012-08-19 11:59 | 15M | |
| Christophe Fontana -..> | 2012-08-19 11:52 | 14M | |
| Chrizz Luvly - Love ..> | 2012-08-19 11:50 | 13M | |
| Chrizz Luvly - Ravea..> | 2012-08-19 11:59 | 12M | |
| Chuckie,Gregori Klos..> | 2012-08-19 11:47 | 12M | |
| Chuckie vs Black Eye..> | 2012-08-19 11:55 | 13M | |
| Ciara - Love Sex Mag..> | 2012-08-19 11:57 | 7.5M | |
| Ciprian Robu Ft. Bla..> | 2012-08-19 11:51 | 7.9M | |
| Claudia Pavel - Out ..> | 2012-08-19 11:59 | 6.8M | |
| Clubraiders - Move Y..> | 2012-08-19 11:54 | 14M | |
| Congorock feat. Mr. ..> | 2012-08-19 11:52 | 5.9M | |
| Conjure One Feat. Ja..> | 2012-08-19 11:59 | 22M | |
| Conjure One feat. Si..> | 2012-08-19 11:51 | 19M | |
| ConnectR - Ring The ..> | 2012-08-19 11:52 | 7.7M | |
| Corina - Munky Funky..> | 2012-08-19 11:52 | 8.0M | |
| Corina feat. JJ - no..> | 2012-08-19 11:47 | 8.1M | |
| D-Block & S-Te-Fan -..> | 2012-08-19 11:53 | 15M | |
| D.O.N.S. & Shahin fe..> | 2012-08-19 11:54 | 12M | |
| DJ's United - Rememb..> | 2012-08-19 11:55 | 17M | |
| DJ Alex Spark - Fly ..> | 2012-08-19 11:54 | 12M | |
| DJ Andi Feat Stella ..> | 2012-08-19 11:55 | 8.8M | |
| DJ Antoine & Laurent..> | 2012-08-19 12:00 | 15M | |
| DJ Antonio - Hallowe..> | 2012-08-19 12:00 | 10M | |
| DJ DimixeR - We Want..> | 2012-08-19 11:55 | 9.7M | |
| DJ Dron - Hard Bass ..> | 2012-08-19 12:00 | 8.2M | |
| DJ Dubi - Baila Mor..> | 2012-08-19 11:45 | 12M | |
| DJ Eugene Galaxy fea..> | 2012-08-19 11:55 | 8.7M | |
| DJ Feel & Aurosonic ..> | 2012-08-19 11:56 | 16M | |
| DJ Feel & Matisse - ..> | 2012-08-19 11:56 | 8.1M | |
| DJ Fist & Rio Dela D..> | 2012-08-19 11:54 | 16M | |
| DJ Fisun - Melody (O..> | 2012-08-19 11:58 | 12M | |
| DJ Fresh - Gold Dust..> | 2012-08-19 11:52 | 7.1M | |
| DJ Fresh - Louder.mp3 | 2012-08-19 11:55 | 7.9M | |
| DJ Groover - At Nigh..> | 2012-08-19 11:51 | 18M | |
| DJ HaLF & Alex Need ..> | 2012-08-19 11:59 | 14M | |
| DJ Herbie Matteo G F..> | 2012-08-19 12:00 | 13M | |
| DJ IMIX - Virtuoso (..> | 2012-08-19 12:00 | 12M | |
| DJ Kuba & NE!TAN - D..> | 2012-08-19 11:48 | 12M | |
| DJ LightCast - Never..> | 2012-08-19 11:55 | 8.1M | |
| DJ NIL & Anthony El ..> | 2012-08-19 11:57 | 17M | |
| DJ NIL - Angry Birds..> | 2012-08-19 11:52 | 7.6M | |
| DJ Nil vs. Quincy Jo..> | 2012-08-19 11:52 | 13M | |
| DJ Noodles feat. Pit..> | 2012-08-19 11:58 | 11M | |
| DJ Sandro Escobar - ..> | 2012-08-19 11:58 | 6.9M | |
| DJ Sandro Escobar an..> | 2012-08-19 11:58 | 7.8M | |
| DJ Sandro Escobar an..> | 2012-08-19 11:50 | 12M | |
| DJ Sava Ft Andreea -..> | 2012-08-19 11:57 | 14M | |
| DJ TLX - Baila Me (C..> | 2012-08-19 11:53 | 14M | |
| DJ Tiësto - Escape..> | 2012-08-19 12:00 | 9.9M | |
| DJ Trieu - Whenever ..> | 2012-08-19 11:51 | 18M | |
| Da Singh RP - Be My ..> | 2012-08-19 11:57 | 12M | |
| Dab & Sushy - Wrong ..> | 2012-08-19 11:50 | 12M | |
| Dakota - Sinners.mp3 | 2012-08-19 11:52 | 5.8M | |
| Damien Fernandez - R..> | 2012-08-19 11:59 | 7.5M | |
| Dan Balan & Prodigy ..> | 2012-08-19 11:56 | 7.9M | |
| Dan Balan - Chica Bo..> | 2012-08-19 11:52 | 11M | |
| Dan Balan - Freedom ..> | 2012-08-19 11:53 | 13M | |
| Dan Balan - Justify ..> | 2012-08-19 11:59 | 10M | |
| Dan Viaz - Cycling U..> | 2012-08-19 11:58 | 16M | |
| Danny Byrd Feat. I-K..> | 2012-08-19 11:47 | 11M | |
| Dan van Eijk - Dream..> | 2012-08-19 11:58 | 17M | |
| Dark Matters feat. A..> | 2012-08-19 11:57 | 16M | |
| Darude - In the Dark..> | 2012-08-19 11:58 | 16M | |
| Darwin & Backwall - ..> | 2012-08-19 11:54 | 14M | |
| Dash Berlin - Earth ..> | 2012-08-19 11:58 | 19M | |
| Dash Berlin feat Emm..> | 2012-08-19 11:54 | 19M | |
| Datamotion - Lose Co..> | 2012-08-19 11:52 | 8.7M | |
| Dave202 vs. Cerf, Mi..> | 2012-08-19 12:00 | 17M | |
| Dave Aude feat. Isha..> | 2012-08-19 11:59 | 19M | |
| Dave Darell vs. Klin..> | 2012-08-19 11:58 | 8.6M | |
| David Deejay feat. D..> | 2012-08-19 11:54 | 7.4M | |
| David Guetta & Afroj..> | 2012-08-19 11:53 | 9.5M | |
| David Guetta & Snoop..> | 2012-08-19 11:56 | 10M | |
| David Guetta - Bass ..> | 2012-08-19 11:58 | 12M | |
| David Guetta feat. T..> | 2012-08-19 11:55 | 15M | |
| David Guetta feat N..> | 2012-08-19 12:00 | 15M | |
| David Vendetta - Fre..> | 2012-08-19 11:53 | 17M | |
| David Vendetta Feat...> | 2012-08-19 11:56 | 7.8M | |
| De Vox - We Fly Away..> | 2012-08-19 11:58 | 16M | |
| Deep Reason - In The..> | 2012-08-19 11:56 | 8.6M | |
| DeepSystem feat. Jay..> | 2012-08-19 11:56 | 7.4M | |
| Deepcentral - Speed ..> | 2012-08-19 11:53 | 14M | |
| Deepest Blue Ft. Syn..> | 2012-08-19 11:55 | 19M | |
| Defcon Audio feat. J..> | 2012-08-19 11:51 | 20M | |
| Delerium - After All..> | 2012-08-19 11:54 | 12M | |
| Delerium - Lost & Fo..> | 2012-08-19 11:56 | 13M | |
| Delia - Dale (Radio ..> | 2012-08-19 11:55 | 7.6M | |
| Delirium vs DJ Obser..> | 2012-08-19 11:54 | 17M | |
| Deniz Kasum - Second..> | 2012-08-19 11:58 | 13M | |
| Deniz Koyu - Tung! (..> | 2012-08-19 11:53 | 14M | |
| Der Mystik Feat Tiff..> | 2012-08-19 11:51 | 19M | |
| Desislava - I like.mp3 | 2012-08-19 11:59 | 7.4M | |
| Dev - In the Dark.mp3 | 2012-08-19 12:00 | 8.9M | |
| Diana Diez & Kostas ..> | 2012-08-19 11:58 | 11M | |
| Dido - Everything To..> | 2012-08-19 11:58 | 13M | |
| Die Atzen Mit Nena -..> | 2012-08-19 11:57 | 11M | |
| Digital Kings - Atte..> | 2012-08-19 11:58 | 7.6M | |
| Dim Chris feat. Aman..> | 2012-08-19 11:54 | 16M | |
| Dinka - On The Beach..> | 2012-08-19 11:56 | 12M | |
| Diplo, Tiesto - C'Mo..> | 2012-08-19 11:43 | 12M | |
| Dirty Alcool - Leech..> | 2012-08-19 11:53 | 6.9M | |
| Dirty Diamonds - Ins..> | 2012-08-19 11:50 | 13M | |
| Disco Freak - Untitl..> | 2012-08-19 11:53 | 15M | |
| Dj Antonio - Bazilio..> | 2012-08-19 12:00 | 12M | |
| Dj Bomba vs. Alex M ..> | 2012-08-19 11:54 | 14M | |
| Dj Dark feat.Sonny F..> | 2012-08-19 11:55 | 12M | |
| Dj Feel - Crash & B..> | 2012-08-19 11:59 | 10M | |
| Dj Frank E Ft Dada L..> | 2012-08-19 12:00 | 7.4M | |
| Dj Luchetta - Take Y..> | 2012-08-19 11:59 | 10M | |
| Dj Mart Dj Zhukovsky..> | 2012-08-19 11:57 | 9.4M | |
| Dj Miller - Club lon..> | 2012-08-19 11:53 | 9.6M | |
| Dj Nil and El Mejor ..> | 2012-08-19 11:52 | 8.5M | |
| Dj Nil feat. Miss N ..> | 2012-08-19 11:57 | 7.8M | |
| Dj Robert Georgescu ..> | 2012-08-19 11:54 | 7.6M | |
| Dj Rynno ft. Sonny F..> | 2012-08-19 11:56 | 14M | |
| Dj Sasha Style - Sto..> | 2012-08-19 11:58 | 12M | |
| Dj Soulstar - Drum D..> | 2012-08-19 12:00 | 15M | |
| Djs from Mars vs Bro..> | 2012-08-19 11:57 | 16M | |
| Don Omar Feat. Lucen..> | 2012-08-19 11:59 | 12M | |
| Dony ft. Elena Gheor..> | 2012-08-19 11:53 | 8.5M | |
| Double Stars ft. Mik..> | 2012-08-19 11:52 | 13M | |
| Dr. Dre and Eminem -..> | 2012-08-19 11:59 | 15M | |
| Dr. Kucho vs Jacobse..> | 2012-08-19 12:00 | 16M | |
| Dreastic - Spirit (D..> | 2012-08-19 11:53 | 17M | |
| Drumsound & Bassline..> | 2012-08-19 11:58 | 7.0M | |
| Duffy - My Boy (The ..> | 2012-08-19 11:58 | 12M | |
| East Coast Masif Lis..> | 2012-08-19 11:47 | 11M | |
| Electric Lady Lab - ..> | 2012-08-19 11:55 | 16M | |
| Electrixx - Crispy C..> | 2012-08-19 11:57 | 13M | |
| Electro Deejay - Par..> | 2012-08-19 11:58 | 8.9M | |
| Elena - Disco Romanc..> | 2012-08-19 11:42 | 10M | |
| Elena - Midnight Sun..> | 2012-08-19 11:47 | 7.6M | |
| Ellie White - Love A..> | 2012-08-19 11:55 | 7.0M | |
| Ellie White - Power ..> | 2012-08-19 11:40 | 7.3M | |
| Elvana Gjata feat Pi..> | 2012-08-19 11:58 | 9.4M | |
| Emigiel and TeLLo - ..> | 2012-08-19 11:55 | 16M | |
| Emil Lassaria feat. ..> | 2012-08-19 11:59 | 15M | |
| Emily Osment - All T..> | 2012-08-19 12:00 | 5.3M | |
| Emmanuel G - La Ola ..> | 2012-08-19 11:58 | 8.0M | |
| Empire Of The Sun - ..> | 2012-08-19 11:45 | 12M | |
| Emre Altug - Bu Kada..> | 2012-08-19 11:57 | 7.5M | |
| Energy Deejays & Ste..> | 2012-08-19 11:57 | 8.4M | |
| Enrique Iglesias - T..> | 2012-08-19 11:55 | 8.9M | |
| Enrique Iglesias fea..> | 2012-08-19 11:58 | 16M | |
| Eric Faria feat. Mar..> | 2012-08-19 11:58 | 15M | |
| Eric Kupper, K Scope..> | 2012-08-19 11:46 | 15M | |
| Eric Prydz - Niton(S..> | 2012-08-19 11:53 | 14M | |
| Estigma - Broken (Or..> | 2012-08-19 11:58 | 18M | |
| Euphoria Project By ..> | 2012-08-19 11:58 | 14M | |
| Euphoria Project By ..> | 2012-08-19 11:54 | 12M | |
| Euphoria Project by ..> | 2012-08-19 11:56 | 12M | |
| Evan London - One Da..> | 2012-08-19 11:52 | 18M | |
| Example - Changed Th..> | 2012-08-19 11:56 | 13M | |
| Example - Stay Awake..> | 2012-08-19 11:53 | 13M | |
| Example - Watch The ..> | 2012-08-19 11:59 | 19M | |
| Example - kickstarts..> | 2012-08-19 11:53 | 7.0M | |
| FM Audio - Killer 2K..> | 2012-08-19 11:47 | 12M | |
| Faithless - Insomnia..> | 2012-08-19 11:43 | 13M | |
| Faithless feat. Dido..> | 2012-08-19 11:57 | 17M | |
| Far East Movement - ..> | 2012-08-19 11:57 | 7.4M | |
| Far East Movement - ..> | 2012-08-19 12:00 | 9.1M | |
| Far East Movement - ..> | 2012-08-19 12:00 | 7.9M | |
| Far East Movement - ..> | 2012-08-19 11:54 | 9.1M | |
| Far East Movement fe..> | 2012-08-19 11:52 | 12M | |
| Fast Distance - Pasa..> | 2012-08-19 12:00 | 16M | |
| Fast Distance and Di..> | 2012-08-19 12:00 | 17M | |
| Fatali - Inner Depth..> | 2012-08-19 11:52 | 18M | |
| Faydee - Psycho.mp3 | 2012-08-19 11:58 | 8.2M | |
| Feed Me featuring Ta..> | 2012-08-19 11:45 | 8.4M | |
| Ferry Corsten - Chec..> | 2012-08-19 11:52 | 16M | |
| Ferry Corsten - Feel..> | 2012-08-19 11:57 | 7.4M | |
| Ferry Corsten - Punk..> | 2012-08-19 11:58 | 15M | |
| Flo Rida - Puzzle (..> | 2012-08-19 11:50 | 8.5M | |
| Flo Rida feat. Akon ..> | 2012-08-19 11:54 | 12M | |
| Florence & The Machi..> | 2012-08-19 11:56 | 19M | |
| Fly Djs feat. Jimmy ..> | 2012-08-19 11:58 | 6.9M | |
| Fly Project - Goodby..> | 2012-08-19 11:53 | 7.2M | |
| Fly Project - Mandal..> | 2012-08-19 11:54 | 12M | |
| Fonseca vs Lane - Af..> | 2012-08-19 11:59 | 14M | |
| Fragma - Oops Sorry ..> | 2012-08-19 11:55 | 13M | |
| Francesco Diaz & Jef..> | 2012-08-19 11:53 | 14M | |
| Freqhouse & Tim Heal..> | 2012-08-19 11:43 | 11M | |
| Fumin - After Party ..> | 2012-08-19 11:54 | 15M | |
| G-Tek - New School F..> | 2012-08-19 11:49 | 19M | |
| Gaia - status excess..> | 2012-08-19 11:58 | 22M | |
| Gataka vs. Ziki - To..> | 2012-08-19 11:53 | 15M | |
| Geeno Fabulous feat...> | 2012-08-19 11:56 | 7.4M | |
| Generation tropical ..> | 2012-08-19 11:54 | 7.3M | |
| George Acosta feat. ..> | 2012-08-19 11:47 | 14M | |
| Gianni Kosta - Just ..> | 2012-08-19 12:00 | 12M | |
| Global Deejays - Fre..> | 2012-08-19 11:53 | 13M | |
| Gordon Coutts - diff..> | 2012-08-19 11:53 | 17M | |
| Grace - Not Over Yet..> | 2012-08-19 12:00 | 20M | |
| Gravitonas and Roma ..> | 2012-08-19 11:49 | 8.6M | |
| Greg Armano - Stars ..> | 2012-08-19 11:53 | 7.8M | |
| Greg Parys - Get Sex..> | 2012-08-19 11:59 | 17M | |
| Greg Parys - Why Don..> | 2012-08-19 11:57 | 13M | |
| Guenta K - Tubular B..> | 2012-08-19 11:55 | 16M | |
| Gulcin Golgem Kilic ..> | 2012-08-19 11:50 | 17M | |
| Gums-Dont Give Up (C..> | 2012-08-19 11:59 | 13M | |
| Guru Josh feat Laure..> | 2012-08-19 11:53 | 13M | |
| Gym Class Heroes fea..> | 2012-08-19 11:50 | 8.1M | |
| Hakimakli - Dolally ..> | 2012-08-19 11:54 | 16M | |
| Hardwell - Voyage (O..> | 2012-08-19 11:59 | 14M | |
| Heidi Montag - Love ..> | 2012-08-19 11:58 | 7.4M | |
| Heikki L Feat Max C ..> | 2012-08-19 11:56 | 14M | |
| Hemstock & Jennings ..> | 2012-08-19 11:53 | 13M | |
| Henny-M feat. Naya M..> | 2012-08-19 11:55 | 13M | |
| Hijackman and Vitori..> | 2012-08-19 11:53 | 8.7M | |
| Hilary Duff - Reach ..> | 2012-08-19 11:55 | 14M | |
| Holly Valance - Tuck..> | 2012-08-19 11:54 | 7.7M | |
| House Rockerz - Herz..> | 2012-08-19 11:53 | 13M | |
| Housekatze - Rock & ..> | 2012-08-19 11:55 | 13M | |
| Housequake Roog and ..> | 2012-08-19 11:52 | 18M | |
| Hurts - Wonderful Li..> | 2012-08-19 11:55 | 10M | |
| Hypnoxock - Desperta..> | 2012-08-19 11:59 | 17M | |
| I Blame Coco - In Sp..> | 2012-08-19 11:59 | 12M | |
| Ian Carey - Keep On ..> | 2012-08-19 11:55 | 14M | |
| Ian Carey Feat. Mand..> | 2012-08-19 11:51 | 9.7M | |
| Ian Carey feat. Snoo..> | 2012-08-19 11:58 | 10M | |
| Ida Corr vs Fedde Le..> | 2012-08-19 11:43 | 12M | |
| Igor Next and Katrin..> | 2012-08-19 11:42 | 12M | |
| Illuminatorz - Dream..> | 2012-08-19 11:59 | 7.0M | |
| In The Screen feat. ..> | 2012-08-19 11:56 | 14M | |
| Inna - Love (DJ Nejt..> | 2012-08-19 11:50 | 9.0M | |
| Inna - amazing (Dj F..> | 2012-08-19 11:51 | 14M | |
| Inna feat. Flo Rida ..> | 2012-08-19 11:51 | 8.2M | |
| Inna feat. Juan Maga..> | 2012-08-19 11:49 | 10M | |
| Inna ft. Sojo - Summ..> | 2012-08-19 12:00 | 8.7M | |
| Inner Sign feat. Sve..> | 2012-08-19 11:59 | 13M | |
| InterSys - The Islan..> | 2012-08-19 11:59 | 14M | |
| Iris Dee Jay feat. M..> | 2012-08-19 11:52 | 20M | |
| Italobrothers - Cryi..> | 2012-08-19 11:55 | 13M | |
| JES - Around You (Ga..> | 2012-08-19 11:58 | 23M | |
| JLS - The Club Is Al..> | 2012-08-19 11:58 | 8.2M | |
| Jacob van Hage - On ..> | 2012-08-19 11:53 | 17M | |
| Jai Alexander Sarah ..> | 2012-08-19 11:57 | 8.6M | |
| Jakarta - One Fuckin..> | 2012-08-19 11:58 | 13M | |
| Jam and Spoon feat. ..> | 2012-08-19 11:57 | 9.4M | |
| Jason Derulo - In my..> | 2012-08-19 11:59 | 11M | |
| JayBi feat Da Fleiva..> | 2012-08-19 11:47 | 7.7M | |
| Jay Sean & Sway - I ..> | 2012-08-19 11:59 | 8.4M | |
| Jay Sean feat. Pitbu..> | 2012-08-19 11:59 | 7.7M | |
| Jean Claude Ades - I..> | 2012-08-19 11:53 | 7.3M | |
| Jean Roch - Im Alrig..> | 2012-08-19 11:58 | 13M | |
| Jedison, Spinlock, H..> | 2012-08-19 11:43 | 12M | |
| Jennifer Lopez - Pap..> | 2012-08-19 11:55 | 15M | |
| Jennifer Lopez - im ..> | 2012-08-19 11:47 | 12M | |
| Jennifer Lopez feat...> | 2012-08-19 11:58 | 18M | |
| Jim-X feat. Lisa - G..> | 2012-08-19 11:57 | 12M | |
| Joachim Garraud - Ba..> | 2012-08-19 11:56 | 14M | |
| John Modena & Y.A.N...> | 2012-08-19 11:54 | 18M | |
| John O Callaghan and..> | 2012-08-19 11:50 | 18M | |
| Jonas Steur & Jennif..> | 2012-08-19 11:56 | 16M | |
| Jordy Lishious - Rad..> | 2012-08-19 11:54 | 16M | |
| Jorg Schmid feat. Da..> | 2012-08-19 12:00 | 12M | |
| Josh Money feat. Abd..> | 2012-08-19 11:55 | 18M | |
| Juan Magan Feat. Mar..> | 2012-08-19 11:59 | 15M | |
| Judge Jules - The Gr..> | 2012-08-19 11:55 | 19M | |
| Justice Crew ft. Flo..> | 2012-08-19 11:54 | 8.6M | |
| Kaiserdisco - djuma ..> | 2012-08-19 11:51 | 19M | |
| Kalwi & Remi - Find ..> | 2012-08-19 11:55 | 8.1M | |
| Kalwi & Remi - Made ..> | 2012-08-19 11:55 | 11M | |
| Kalwi & Remi - Stop ..> | 2012-08-19 11:56 | 7.3M | |
| Kalwi and Remi feat ..> | 2012-08-19 11:57 | 7.4M | |
| Kamelia - Come again..> | 2012-08-19 11:57 | 13M | |
| Karma - More And Mor..> | 2012-08-19 11:54 | 12M | |
| Kaskade & Tiesto fea..> | 2012-08-19 12:00 | 18M | |
| Kaskade feat. Haley ..> | 2012-08-19 11:56 | 13M | |
| Kat DeLuna - Drop It..> | 2012-08-19 11:53 | 9.1M | |
| Katy B - Broken Reco..> | 2012-08-19 11:58 | 6.9M | |
| Katy B - Easy Please..> | 2012-08-19 11:57 | 9.0M | |
| Katy B - Katy On A M..> | 2012-08-19 11:55 | 7.9M | |
| Katy Perry - Circle ..> | 2012-08-19 11:49 | 10M | |
| Ke$ha-Backstabber.mp3 | 2012-08-19 11:55 | 7.3M | |
| Kesha - TikTok (Edso..> | 2012-08-19 11:59 | 20M | |
| Kim Sozzi - Rated R.mp3 | 2012-08-19 11:44 | 9.2M | |
| Kindervater feat. Ma..> | 2012-08-19 11:50 | 14M | |
| Kissloyd & Lafresh -..> | 2012-08-19 11:58 | 11M | |
| Kittens - Im In Love..> | 2012-08-19 11:56 | 8.0M | |
| Klaas & Bodybangers ..> | 2012-08-19 11:49 | 8.1M | |
| Komodo - Keep Contro..> | 2012-08-19 11:55 | 14M | |
| Kristine - Feel The ..> | 2012-08-19 11:47 | 12M | |
| Kyau & Albert - A Ni..> | 2012-08-19 11:59 | 14M | |
| Kyau & Albert - Kiks..> | 2012-08-19 11:59 | 16M | |
| Kyau & Albert - Pain..> | 2012-08-19 11:59 | 18M | |
| Kylian Mash & Ekow F..> | 2012-08-19 11:57 | 8.1M | |
| Kylian Mash,Akon,and..> | 2012-08-19 11:51 | 7.8M | |
| LMFAO feat. Natalia ..> | 2012-08-19 11:49 | 11M | |
| LaLo Project - dont ..> | 2012-08-19 12:00 | 8.8M | |
| Lady GaGa - Judas (R..> | 2012-08-19 11:59 | 11M | |
| Lady Gaga - Alejandr..> | 2012-08-19 11:55 | 8.9M | |
| Lady Gaga - electric..> | 2012-08-19 12:00 | 15M | |
| Ladytron - Ace of Hz..> | 2012-08-19 11:56 | 17M | |
| Laidback Luce - My G..> | 2012-08-19 11:59 | 8.8M | |
| Laidback Luke & Stev..> | 2012-08-19 11:58 | 16M | |
| Laidback Luke - Till..> | 2012-08-19 12:00 | 16M | |
| Laidback Luke feat J..> | 2012-08-19 11:55 | 14M | |
| Lange & Fabio XB pre..> | 2012-08-19 11:51 | 18M | |
| Laurent Pepper feat...> | 2012-08-19 11:59 | 12M | |
| Laurent Wery feat. S..> | 2012-08-19 11:56 | 13M | |
| Laurent Wolf feat. J..> | 2012-08-19 12:00 | 14M | |
| Lazy Rich Ft. Cassan..> | 2012-08-19 11:57 | 13M | |
| Lazy Rich Ft. Lizze ..> | 2012-08-19 11:58 | 14M | |
| Leaf feat. Sky Blu -..> | 2012-08-19 12:00 | 9.7M | |
| Limp Bizkit - Behind..> | 2012-08-19 11:55 | 13M | |
| Lissat & Voltaxx - Y..> | 2012-08-19 11:53 | 14M | |
| Livvi Franc - Automa..> | 2012-08-19 11:57 | 15M | |
| Lockhard feat. David..> | 2012-08-19 11:49 | 13M | |
| Lodos - Moody (Origi..> | 2012-08-19 11:56 | 17M | |
| Loona - El Tiburon (..> | 2012-08-19 11:53 | 14M | |
| Lora - No More Tears..> | 2012-08-19 11:58 | 6.6M | |
| Lord Kossity - Sexy ..> | 2012-08-19 11:47 | 7.2M | |
| Luke Silver vs. Jess..> | 2012-08-19 11:54 | 11M | |
| Lustral - I Feel You..> | 2012-08-19 11:53 | 16M | |
| Lykke Li - Little Bi..> | 2012-08-19 11:54 | 9.0M | |
| Madcon ft. Maad Mois..> | 2012-08-19 11:56 | 8.8M | |
| Madison - Why (Radio..> | 2012-08-19 11:50 | 8.1M | |
| Marcel, Stefano Pain..> | 2012-08-19 11:58 | 16M | |
| Marco V - unprepared..> | 2012-08-19 11:58 | 19M | |
| Marco Van Bassken - ..> | 2012-08-19 11:55 | 8.4M | |
| Marco Zardi Andry J ..> | 2012-08-19 11:56 | 13M | |
| Marcus Maison & Will..> | 2012-08-19 11:55 | 16M | |
| Marcus Maison & Will..> | 2012-08-19 11:54 | 15M | |
| Marcus Schossow & Re..> | 2012-08-19 11:53 | 17M | |
| Marcus Schossow - Ac..> | 2012-08-19 11:56 | 15M | |
| Mario Hammer feat As..> | 2012-08-19 11:54 | 16M | |
| Mark Knight - Devil ..> | 2012-08-19 11:52 | 17M | |
| Mark Pledger & Rake ..> | 2012-08-19 12:00 | 21M | |
| Mark Sherry - Fractu..> | 2012-08-19 11:55 | 17M | |
| Marko Manzzoti feat...> | 2012-08-19 11:52 | 9.6M | |
| Markus Schulz - 65.4..> | 2012-08-19 11:59 | 9.5M | |
| Markus Schulz And Jo..> | 2012-08-19 11:53 | 16M | |
| Maroon 5 - Misery (B..> | 2012-08-19 12:00 | 16M | |
| Maroon 5 - This Love..> | 2012-08-19 12:00 | 12M | |
| Maroon 5 feat. Chris..> | 2012-08-19 12:00 | 15M | |
| Marquess - Chapoteo.mp3 | 2012-08-19 11:59 | 7.0M | |
| Martin Solveig - boy..> | 2012-08-19 11:58 | 8.0M | |
| Martin Solveig ft. K..> | 2012-08-19 11:58 | 15M | |
| Martin Solveig ft Dr..> | 2012-08-19 11:59 | 17M | |
| Marvin Priest - Own ..> | 2012-08-19 11:49 | 7.8M | |
| Masoud feat. Hannah ..> | 2012-08-19 11:56 | 18M | |
| Mastiksoul, Dada Fea..> | 2012-08-19 11:53 | 14M | |
| Matisse & Sadko - Sv..> | 2012-08-19 11:56 | 15M | |
| Matt Hardwick vs. Gu..> | 2012-08-19 11:57 | 16M | |
| Mattheo pres. Nucled..> | 2012-08-19 11:59 | 11M | |
| Mattias - Get Your H..> | 2012-08-19 11:59 | 13M | |
| Mauro Picotto Vs. Th..> | 2012-08-19 11:54 | 14M | |
| Max Bragantini Aka M..> | 2012-08-19 11:54 | 15M | |
| Max Fabian feat. MC ..> | 2012-08-19 11:53 | 8.1M | |
| Max Farenthide - 1, ..> | 2012-08-19 11:59 | 16M | |
| Max Graham feat. Ana..> | 2012-08-19 12:00 | 18M | |
| Medina - Addiction.mp3 | 2012-08-19 11:54 | 8.4M | |
| Menno De Jong - Turt..> | 2012-08-19 12:00 | 19M | |
| Menno De Jong feat E..> | 2012-08-19 12:00 | 18M | |
| Micha Moor - Slip ..> | 2012-08-19 11:58 | 16M | |
| Mick Kastenholt - Ma..> | 2012-08-19 12:00 | 12M | |
| Midi Maxi and Efti -..> | 2012-08-19 11:59 | 12M | |
| Midnighters - Never ..> | 2012-08-19 12:00 | 12M | |
| Mika Vyne - Just One..> | 2012-08-19 11:58 | 6.5M | |
| Mike & Smith - Tranc..> | 2012-08-19 11:53 | 15M | |
| Mike Candys - Togeth..> | 2012-08-19 12:00 | 11M | |
| Mike De Ville - Pump..> | 2012-08-19 11:54 | 12M | |
| Mike Koglin - Sunsta..> | 2012-08-19 11:55 | 18M | |
| Mike Posner - Cooler..> | 2012-08-19 11:59 | 13M | |
| Mike Shiver & Aruna ..> | 2012-08-19 11:51 | 17M | |
| Mike Shiver vs. Mati..> | 2012-08-19 11:59 | 19M | |
| Miley Cyrus - Can't ..> | 2012-08-19 11:57 | 13M | |
| Miley Cyrus - Who ow..> | 2012-08-19 12:00 | 14M | |
| Milk & Honey - Didi ..> | 2012-08-19 11:54 | 7.7M | |
| Milk And Sugar Vs Va..> | 2012-08-19 11:53 | 12M | |
| Mishelle feat Randi ..> | 2012-08-19 11:54 | 12M | |
| Miss Ventura - Can Y..> | 2012-08-19 11:56 | 7.6M | |
| Modestep - Sunlight ..> | 2012-08-19 11:55 | 12M | |
| Moguai vs Laidback L..> | 2012-08-19 11:56 | 15M | |
| Mohombi - Bumpy Ride..> | 2012-08-19 11:54 | 8.0M | |
| Moonbeam - We Are In..> | 2012-08-19 11:59 | 7.9M | |
| Morgan Page, Sultan ..> | 2012-08-19 11:55 | 9.0M | |
| Morris - Angel Eyes ..> | 2012-08-19 11:59 | 14M | |
| Mory Kante vs Loveru..> | 2012-08-19 11:53 | 17M | |
| Musetta - Standing B..> | 2012-08-19 11:50 | 20M | |
| N.O.H.A. - Tu Cafe (..> | 2012-08-19 12:00 | 12M | |
| Nadia Ali, Starkille..> | 2012-08-19 11:59 | 14M | |
| Nadia Ali - The One_..> | 2012-08-19 11:58 | 18M | |
| Nadia Ali - rapture ..> | 2012-08-19 11:56 | 18M | |
| Nadia Oh - Is That Y..> | 2012-08-19 11:38 | 6.3M | |
| Nadia Oh - S.E.X..mp3 | 2012-08-19 11:48 | 7.6M | |
| Narcotic Sound feat...> | 2012-08-19 11:56 | 10M | |
| Natalia Damini - You..> | 2012-08-19 11:54 | 15M | |
| Nayer feat Pitbull -..> | 2012-08-19 11:54 | 8.5M | |
| Nektarios Mees Kirst..> | 2012-08-19 11:58 | 15M | |
| Nenes & Pascal Feliz..> | 2012-08-19 11:54 | 15M | |
| Neoclubber - Feel Th..> | 2012-08-19 11:44 | 8.0M | |
| Nero - Guilt (VIP Mi..> | 2012-08-19 12:00 | 11M | |
| Nero - Innocence.mp3 | 2012-08-19 11:56 | 12M | |
| Nero - Promises (Cal..> | 2012-08-19 11:59 | 14M | |
| New Boyz ft. The Cat..> | 2012-08-19 11:47 | 8.7M | |
| Nicky Romero - Growl..> | 2012-08-19 11:59 | 14M | |
| Nicole Scherzinger -..> | 2012-08-19 11:59 | 7.0M | |
| Niels van Gogh vs. D..> | 2012-08-19 11:55 | 13M | |
| Novaspace - Close Yo..> | 2012-08-19 11:58 | 14M | |
| ONO - Move On Fast (..> | 2012-08-19 11:53 | 15M | |
| Offbeat Orchestra - ..> | 2012-08-19 12:00 | 14M | |
| Oh Land - Sun Of A G..> | 2012-08-19 11:54 | 18M | |
| Olivier Darock - gir..> | 2012-08-19 11:53 | 8.0M | |
| Omonimo & Luca Bello..> | 2012-08-19 11:54 | 15M | |
| Overdrive Division -..> | 2012-08-19 11:57 | 14M | |
| Paul Gardner - Music..> | 2012-08-19 11:57 | 17M | |
| Paul Oakenfold & Mar..> | 2012-08-19 12:00 | 13M | |
| Paul Oakenfold - Tok..> | 2012-08-19 11:59 | 17M | |
| Paul Oakenfold feat...> | 2012-08-19 11:38 | 7.2M | |
| Paul Vinitsky pres. ..> | 2012-08-19 11:56 | 19M | |
| Paulo Martins - Come..> | 2012-08-19 11:53 | 15M | |
| Pedro Carrilho feat...> | 2012-08-19 11:57 | 15M | |
| Pedro Del Mar feat. ..> | 2012-08-19 11:55 | 20M | |
| Pendulum - Witchcraf..> | 2012-08-19 11:59 | 13M | |
| Phillip Alpha - Vale..> | 2012-08-19 11:59 | 17M | |
| Phuckheads - Breakin..> | 2012-08-19 11:45 | 8.9M | |
| Phunktjan - Let The ..> | 2012-08-19 11:54 | 15M | |
| Pitbull - I Know You..> | 2012-08-19 11:53 | 14M | |
| Pitbull ft. Marc Ant..> | 2012-08-19 11:42 | 8.9M | |
| Pitbull ft Enrique I..> | 2012-08-19 11:55 | 14M | |
| Pixie Lott - Here We..> | 2012-08-19 11:54 | 7.2M | |
| Play & Win - Ya BB (..> | 2012-08-19 11:47 | 6.7M | |
| Pleasurekraft - Carn..> | 2012-08-19 11:53 | 14M | |
| Pleasurekraft - Tara..> | 2012-08-19 11:44 | 15M | |
| Pro Luxe - Sun Goes ..> | 2012-08-19 11:57 | 14M | |
| Psyko Punkz - BassBo..> | 2012-08-19 12:00 | 13M | |
| Quick Jaxx - Hey Bil..> | 2012-08-19 11:59 | 11M | |
| R.I.O - Hot Girl (Wi..> | 2012-08-19 11:56 | 11M | |
| RMB - Spring 2011 (J..> | 2012-08-19 11:59 | 17M | |
| RabbitKiller & Steep..> | 2012-08-19 11:55 | 15M | |
| Radio Killer - Be Fr..> | 2012-08-19 11:59 | 11M | |
| Radio Killer - Lonel..> | 2012-08-19 11:55 | 12M | |
| Radio Killer Ft. Smi..> | 2012-08-19 11:59 | 7.5M | |
| Ralph Fridge - Angel..> | 2012-08-19 11:59 | 16M | |
| Ralvero - Switch Tha..> | 2012-08-19 12:00 | 16M | |
| Ralvero and Dadz N E..> | 2012-08-19 11:59 | 5.4M | |
| Rammstein - Du Hast ..> | 2012-08-19 11:58 | 12M | |
| Rares and Joshua Fea..> | 2012-08-19 11:59 | 9.5M | |
| Rave channel - never..> | 2012-08-19 11:52 | 9.3M | |
| Red Hot Chili Pepper..> | 2012-08-19 12:00 | 15M | |
| Rene Rodrigezz - Roc..> | 2012-08-19 11:54 | 12M | |
| Richard Durand feat...> | 2012-08-19 12:00 | 14M | |
| Richard Durand feat...> | 2012-08-19 12:00 | 19M | |
| Richard Vission, Tra..> | 2012-08-19 11:57 | 16M | |
| Ricky L feat. M-CK -..> | 2012-08-19 11:55 | 8.1M | |
| Rico Bernasconi & Be..> | 2012-08-19 11:54 | 12M | |
| Rico Bernasconi Vs. ..> | 2012-08-19 11:54 | 15M | |
| Rihanna - S & M (Sid..> | 2012-08-19 11:57 | 16M | |
| Rob and Chris - Eska..> | 2012-08-19 11:59 | 11M | |
| Rob and Chris - Wahn..> | 2012-08-19 11:57 | 7.5M | |
| Robbie Neji Feat Ben..> | 2012-08-19 11:55 | 9.0M | |
| Robert Burian feat. ..> | 2012-08-19 11:59 | 18M | |
| Robert Nickson feat...> | 2012-08-19 11:58 | 16M | |
| Robert Vadney - fall..> | 2012-08-19 11:56 | 21M | |
| Robo Burian - Forum.mp3 | 2012-08-19 11:58 | 17M | |
| Robyn and Rye Rye - ..> | 2012-08-19 11:44 | 9.6M | |
| Rock Solid Mafia - S..> | 2012-08-19 11:54 | 17M | |
| Roger Sanchez - Lost..> | 2012-08-19 11:58 | 15M | |
| Rokcity-Grenade (Ori..> | 2012-08-19 11:54 | 15M | |
| Roller Sis feat. Adr..> | 2012-08-19 11:59 | 13M | |
| Rotation - Cyclone.mp3 | 2012-08-19 11:58 | 17M | |
| Rusko - Hold On (fea..> | 2012-08-19 11:53 | 10M | |
| Sak Noel - Loca Peop..> | 2012-08-19 11:58 | 12M | |
| SamNSK - Hi!.mp3 | 2012-08-19 11:52 | 9.4M | |
| Sander Lite feat. Le..> | 2012-08-19 11:57 | 8.8M | |
| Sander Van Doorn fea..> | 2012-08-19 11:57 | 7.6M | |
| Sander Van Doorn pre..> | 2012-08-19 12:00 | 17M | |
| Sander van Doorn - K..> | 2012-08-19 11:54 | 13M | |
| Sandro Peres - Sanfo..> | 2012-08-19 11:56 | 8.5M | |
| Sarah Connor - Cold ..> | 2012-08-19 11:57 | 8.9M | |
| Sash! - Adelante (El..> | 2012-08-19 11:59 | 14M | |
| Saten - Miracles (Ps..> | 2012-08-19 11:57 | 19M | |
| Scarmix and Remakerz..> | 2012-08-19 11:53 | 7.2M | |
| Scooter - Weekend (P..> | 2012-08-19 11:55 | 15M | |
| Scooter and Lavelle ..> | 2012-08-19 11:59 | 14M | |
| Sean Tyas - banshee ..> | 2012-08-19 11:59 | 18M | |
| Second Left feat Sus..> | 2012-08-19 12:00 | 14M | |
| Seight - Bass Attitu..> | 2012-08-19 11:56 | 7.5M | |
| Selena Gomez & The S..> | 2012-08-19 11:53 | 13M | |
| Selena Gomez & The S..> | 2012-08-19 11:57 | 7.8M | |
| Selena Gomez & The S..> | 2012-08-19 11:54 | 8.4M | |
| Shakira & Pitbull - ..> | 2012-08-19 11:54 | 13M | |
| Shakira, Pacha All S..> | 2012-08-19 11:56 | 19M | |
| Shakira feat Dizzee ..> | 2012-08-19 12:00 | 16M | |
| Shakira ft. Pitbull ..> | 2012-08-19 11:51 | 9.8M | |
| Shalaine Mezzo - Don..> | 2012-08-19 11:55 | 8.4M | |
| Sheryfa Luna - Il ya..> | 2012-08-19 11:52 | 8.0M | |
| Signum feat. Kate Lo..> | 2012-08-19 11:54 | 16M | |
| Simon De Jano and Ki..> | 2012-08-19 11:58 | 13M | |
| Simon Patterson & Gr..> | 2012-08-19 11:54 | 17M | |
| Sly One Vs Jurrane -..> | 2012-08-19 11:55 | 20M | |
| Snatt & Vix Ft. Alex..> | 2012-08-19 11:52 | 7.9M | |
| Snoop Dogg - Sweat (..> | 2012-08-19 11:56 | 7.5M | |
| Sonic Palms - On the..> | 2012-08-19 11:59 | 14M | |
| Sophie Ellis-Bextor ..> | 2012-08-19 11:59 | 11M | |
| Sophie Ellis-Bextor ..> | 2012-08-19 11:49 | 8.1M | |
| Spankers - Chupa Ric..> | 2012-08-19 11:53 | 12M | |
| Spencer & Hill vs. D..> | 2012-08-19 11:58 | 14M | |
| Spencer and Hill vs ..> | 2012-08-19 11:59 | 7.6M | |
| Stanislav Beta feat...> | 2012-08-19 11:57 | 16M | |
| Stee Wee Bee feat. S..> | 2012-08-19 11:51 | 8.2M | |
| Steve Kaetzel feat. ..> | 2012-08-19 11:59 | 17M | |
| Stream Dance Project..> | 2012-08-19 11:57 | 13M | |
| Stromae - Alors On D..> | 2012-08-19 11:52 | 11M | |
| Stromae - House Llel..> | 2012-08-19 11:55 | 7.2M | |
| Studio B - I See Gir..> | 2012-08-19 11:44 | 15M | |
| Studio Killers - Ode..> | 2012-08-19 11:59 | 15M | |
| Sub Focus - Could Th..> | 2012-08-19 11:53 | 10M | |
| Sub Focus - Let the ..> | 2012-08-19 11:53 | 11M | |
| Sub Focus - stomp.mp3 | 2012-08-19 11:53 | 10M | |
| Sub Focus - triple X..> | 2012-08-19 11:55 | 9.3M | |
| Sun Decade feat. Emm..> | 2012-08-19 11:57 | 18M | |
| Supahit - everything..> | 2012-08-19 11:56 | 13M | |
| Super8 and Tab feat...> | 2012-08-19 11:56 | 19M | |
| Supermode - Tell Me ..> | 2012-08-19 11:59 | 15M | |
| Supersonic Future - ..> | 2012-08-19 11:56 | 12M | |
| Swedish House Mafia ..> | 2012-08-19 11:53 | 14M | |
| Syke N Sugarstarr & ..> | 2012-08-19 11:54 | 15M | |
| Sylver - Foreign Aff..> | 2012-08-19 11:57 | 17M | |
| Sylver - Forgiven (J..> | 2012-08-19 11:57 | 16M | |
| Sylver - Turn The Ti..> | 2012-08-19 11:53 | 17M | |
| T&F Project - Fresh ..> | 2012-08-19 11:56 | 13M | |
| T&F Project - Noise ..> | 2012-08-19 11:43 | 12M | |
| T&F Project And Vale..> | 2012-08-19 11:58 | 12M | |
| Taio Cruz Feat. Kyli..> | 2012-08-19 12:00 | 15M | |
| Tantrum Desire - Hig..> | 2012-08-19 11:52 | 11M | |
| Technikal vs K-Serie..> | 2012-08-19 12:00 | 16M | |
| The Black Eyed Peas,..> | 2012-08-19 11:54 | 10M | |
| The Black Eyed Peas ..> | 2012-08-19 11:54 | 14M | |
| The Black Eyed Peas ..> | 2012-08-19 11:53 | 15M | |
| The Black Eyed Peas ..> | 2012-08-19 11:56 | 12M | |
| The Black Eyed Peas ..> | 2012-08-19 11:54 | 14M | |
| The Black Eyed Peas ..> | 2012-08-19 11:56 | 12M | |
| The Cataracs feat. D..> | 2012-08-19 11:56 | 11M | |
| The Coolbreezers - S..> | 2012-08-19 11:54 | 11M | |
| The D.O.K. vs. Farin..> | 2012-08-19 11:55 | 8.1M | |
| The Only One (Club M..> | 2012-08-19 11:54 | 12M | |
| The Partysquad feat ..> | 2012-08-19 11:54 | 7.5M | |
| The Prodigy - Smack ..> | 2012-08-19 11:58 | 16M | |
| The Reason 4 - Take ..> | 2012-08-19 11:58 | 13M | |
| The Riddler - fille ..> | 2012-08-19 11:54 | 16M | |
| The Saturdays - Not ..> | 2012-08-19 11:52 | 7.3M | |
| The Saturdays - Noto..> | 2012-08-19 11:52 | 15M | |
| The Thrillseekers - ..> | 2012-08-19 11:51 | 19M | |
| Therese - Remedy (Ex..> | 2012-08-19 11:58 | 13M | |
| Thierry de Broca - B..> | 2012-08-19 11:59 | 8.6M | |
| Three 'N One pres. J..> | 2012-08-19 11:59 | 15M | |
![[ ]](/icons/unknown.gif) | Thumbs.db | 2009-01-01 10:37 | 14K | |
| Tiddey feat. Lyck - ..> | 2012-08-19 11:51 | 19M | |
| Tiesto - Knock You O..> | 2012-08-19 11:59 | 13M | |
| Tiesto - Knock You O..> | 2012-08-19 11:57 | 9.7M | |
| Tiesto - Las Vegas (..> | 2012-08-19 11:58 | 11M | |
| Tiesto - adagio for ..> | 2012-08-19 11:51 | 7.9M | |
| Tiesto and Hardwell ..> | 2012-08-19 11:55 | 14M | |
| Tiesto and Mark Knig..> | 2012-08-19 11:54 | 18M | |
| Tiesto feat. Kay - W..> | 2012-08-19 11:55 | 15M | |
| Tiesto feat. Nelly F..> | 2012-08-19 11:58 | 11M | |
| Tim Berg,Oliver Ingr..> | 2012-08-19 11:52 | 7.2M | |
| Tim Berg - Bromance ..> | 2012-08-19 11:59 | 19M | |
| Tim Healey & Freqhou..> | 2012-08-19 11:55 | 9.2M | |
| Timbaland feat. Pitb..> | 2012-08-19 12:00 | 7.1M | |
| Timmy & Tommy feat. ..> | 2012-08-19 11:51 | 19M | |
| Tinchy Stryder feat...> | 2012-08-19 11:53 | 15M | |
| Tinie Tempah feat. W..> | 2012-08-19 12:00 | 8.6M | |
| Tito Torres feat. Ma..> | 2012-08-19 11:58 | 14M | |
| Tom & Grade - Rock A..> | 2012-08-19 11:54 | 9.2M | |
| Tom Boxer vs Alexand..> | 2012-08-19 11:54 | 12M | |
| Tom Cloud feat Tiff ..> | 2012-08-19 11:57 | 18M | |
| Tony Igy - Astronomi..> | 2012-08-19 11:56 | 9.2M | |
| Trance Arts - progre..> | 2012-08-19 11:57 | 17M | |
| Tripleone - 12 Angel..> | 2012-08-19 11:59 | 20M | |
| Tripple Star - Insur..> | 2012-08-19 11:54 | 7.4M | |
| Tritonal & Sibicky -..> | 2012-08-19 11:57 | 17M | |
| Tucandeo feat. Jenni..> | 2012-08-19 11:52 | 20M | |
| Tydi feat Tania Zyga..> | 2012-08-19 11:59 | 21M | |
| Ummet Ozcan - Shamba..> | 2012-08-19 11:58 | 18M | |
| Usher - Oh My Gosh (..> | 2012-08-19 12:00 | 15M | |
| Utmost DJ's feat Ton..> | 2012-08-19 11:56 | 11M | |
| Vato Gonzalez Fe. Fo..> | 2012-08-19 11:53 | 11M | |
| Veracocha - Carte Bl..> | 2012-08-19 11:51 | 19M | |
| Videokids - Do the r..> | 2012-08-19 11:54 | 13M | |
| Vinny Troia feat. Ja..> | 2012-08-19 11:59 | 20M | |
| Vivo ft. Orel - Feel..> | 2012-08-19 11:55 | 13M | |
| Wawa - No Problem (..> | 2012-08-19 11:59 | 19M | |
| White Label - Party ..> | 2012-08-19 11:50 | 13M | |
| Wolfgang Gartner fea..> | 2012-08-19 12:00 | 13M | |
| Worm feat Anna Herz ..> | 2012-08-19 11:57 | 11M | |
| Wynter Gordon - Til ..> | 2012-08-19 11:56 | 12M | |
| Yanou - Children of ..> | 2012-08-19 11:56 | 17M | |
| Yinon Yahel feat. Em..> | 2012-08-19 11:49 | 8.7M | |
| Yoav - Club Thing (R..> | 2012-08-19 11:53 | 16M | |
| tracklist.txt | 2012-08-19 11:39 | 76K | |
| tyDi & Dennis Sheper..> | 2012-08-19 11:57 | 16M | |
| tyDi feat. Tania Zyg..> | 2012-08-19 11:57 | 16M | |
|
|---|
Apache/2.4.58 (Win64) OpenSSL/3.1.3 PHP/8.2.12 Server at 84.54.185.70 Port 8022